C15H17NO — CID 22173924
3-amino-2-(2,4,5-trimethylphenyl)phenol (PubChem CID 22173924) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-amino-2-(2,4,5-trimethylphenyl)phenol.
| Compound Name | 3-amino-2-(2,4,5-trimethylphenyl)phenol |
|---|---|
| PubChem CID | 22173924 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 3-amino-2-(2,4,5-trimethylphenyl)phenol |
| SMILES | Cc1cc(C)c(-c2c(N)cccc2O)cc1C |
| InChI | InChI=1S/C15H17NO/c1-9-7-11(3)12(8-10(9)2)15-13(16)5-4-6-14(15)17/h4-8,17H,16H2,1-3H3 |
| InChIKey | YBXXUOTYQOYCOX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|