C23H26N2 — CID 70283207
4-[2-(4-amino-2,5-dimethylphenyl)-3-methylphenyl]-2,5-dimethylaniline (PubChem CID 70283207) has the molecular formula C23H26N2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 4-[2-(4-amino-2,5-dimethylphenyl)-3-methylphenyl]-2,5-dimethylaniline.
| Compound Name | 4-[2-(4-amino-2,5-dimethylphenyl)-3-methylphenyl]-2,5-dimethylaniline |
|---|---|
| PubChem CID | 70283207 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 4-[2-(4-amino-2,5-dimethylphenyl)-3-methylphenyl]-2,5-dimethylaniline |
| SMILES | Cc1cc(-c2cccc(C)c2-c2cc(C)c(N)cc2C)c(C)cc1N |
| InChI | InChI=1S/C23H26N2/c1-13-7-6-8-18(19-9-16(4)21(24)11-14(19)2)23(13)20-10-17(5)22(25)12-15(20)3/h6-12H,24-25H2,1-5H3 |
| InChIKey | ACZNLLNKZOGOBZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|