C14H14ClN — CID 23381822
4-(4-chlorophenyl)-2,5-dimethylaniline (PubChem CID 23381822) has the molecular formula C14H14ClN and a molecular weight of 231.73 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,5-dimethylaniline.
| Compound Name | 4-(4-chlorophenyl)-2,5-dimethylaniline |
|---|---|
| PubChem CID | 23381822 |
| Molecular Formula | C14H14ClN |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4-(4-chlorophenyl)-2,5-dimethylaniline |
| SMILES | Cc1cc(-c2ccc(Cl)cc2)c(C)cc1N |
| InChI | InChI=1S/C14H14ClN/c1-9-8-14(16)10(2)7-13(9)11-3-5-12(15)6-4-11/h3-8H,16H2,1-2H3 |
| InChIKey | TZSAYYXTOXWRJL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|