C14H19Cl3O — CID 125466999
(1R)-2,2,2-trichloro-1-[2,5-di(propan-2-yl)phenyl]ethanol (PubChem CID 125466999) has the molecular formula C14H19Cl3O and a molecular weight of 309.66 g/mol. Its IUPAC name is (1R)-2,2,2-trichloro-1-[2,5-di(propan-2-yl)phenyl]ethanol.
| Compound Name | (1R)-2,2,2-trichloro-1-[2,5-di(propan-2-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 125466999 |
| Molecular Formula | C14H19Cl3O |
| Molecular Weight | 309.66 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | (1R)-2,2,2-trichloro-1-[2,5-di(propan-2-yl)phenyl]ethanol |
| SMILES | CC(C)c1ccc(C(C)C)c([C@@H](O)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C14H19Cl3O/c1-8(2)10-5-6-11(9(3)4)12(7-10)13(18)14(15,16)17/h5-9,13,18H,1-4H3/t13-/m1/s1 |
| InChIKey | IARQJNXFADQBRX-CYBMUJFWSA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.66 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|