C15H19ClF4 — CID 79660195
1-(1-chloro-2,2,3,3-tetrafluoropropyl)-2,4-di(propan-2-yl)benzene (PubChem CID 79660195) has the molecular formula C15H19ClF4 and a molecular weight of 310.76 g/mol. Its IUPAC name is 1-(1-chloro-2,2,3,3-tetrafluoropropyl)-2,4-di(propan-2-yl)benzene.
| Compound Name | 1-(1-chloro-2,2,3,3-tetrafluoropropyl)-2,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 79660195 |
| Molecular Formula | C15H19ClF4 |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-(1-chloro-2,2,3,3-tetrafluoropropyl)-2,4-di(propan-2-yl)benzene |
| SMILES | CC(C)c1ccc(C(Cl)C(F)(F)C(F)F)c(C(C)C)c1 |
| InChI | InChI=1S/C15H19ClF4/c1-8(2)10-5-6-11(12(7-10)9(3)4)13(16)15(19,20)14(17)18/h5-9,13-14H,1-4H3 |
| InChIKey | WOLRMGVENABTQV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|