C20H25Cl — CID 63431573
1-[chloro-(3-methylphenyl)methyl]-2,4-di(propan-2-yl)benzene (PubChem CID 63431573) has the molecular formula C20H25Cl and a molecular weight of 300.87 g/mol. Its IUPAC name is 1-[chloro-(3-methylphenyl)methyl]-2,4-di(propan-2-yl)benzene.
| Compound Name | 1-[chloro-(3-methylphenyl)methyl]-2,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 63431573 |
| Molecular Formula | C20H25Cl |
| Molecular Weight | 300.87 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-[chloro-(3-methylphenyl)methyl]-2,4-di(propan-2-yl)benzene |
| SMILES | Cc1cccc(C(Cl)c2ccc(C(C)C)cc2C(C)C)c1 |
| InChI | InChI=1S/C20H25Cl/c1-13(2)16-9-10-18(19(12-16)14(3)4)20(21)17-8-6-7-15(5)11-17/h6-14,20H,1-5H3 |
| InChIKey | RRTOVQSYLDVKKD-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.87 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|