About 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene
1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene (PubChem CID 170971912) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene.
Molecular Properties
| Compound Name | 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene |
| PubChem CID | 170971912 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene |
| SMILES | Cc1cccc(C(C)C)c1.Cc1ccccc1.[H][H] |
| InChI | InChI=1S/C10H14.C7H8.H2/c1-8(2)10-6-4-5-9(3)7-10;1-7-5-3-2-4-6-7;/h4-8H,1-3H3;2-6H,1H3;1H |
| InChIKey | SYYVGOMOFBGHEG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene?
The IUPAC name of 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene (CID 170971912) is 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene.
What is the SMILES notation for 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene?
The canonical SMILES for 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene is Cc1cccc(C(C)C)c1.Cc1ccccc1.[H][H].
What is the InChIKey of 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene?
The InChIKey is SYYVGOMOFBGHEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C7H8.H2/c1-8(2)10-6-4-5-9(3)7-10;1-7-5-3-2-4-6-7;/h4-8H,1-3H3;2-6H,1H3;1H.
What are the key properties of 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene?
1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene has a molecular weight of 228.38 g/mol, XLogP of 5.36, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-propan-2-ylbenzene;molecular hydrogen;toluene is sourced from PubChem (CID 170971912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).