About methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne
methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne (PubChem CID 144521771) has the molecular formula C15H26
and a molecular weight of 206.37 g/mol. Its IUPAC name is methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne.
Molecular Properties
| Compound Name | methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne |
| PubChem CID | 144521771 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne |
| SMILES | C.C.C#CC.Cc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C10H14.C3H4.2CH4/c1-8(2)10-6-4-5-9(3)7-10;1-3-2;;/h4-8H,1-3H3;1H,2H3;2*1H4 |
| InChIKey | YWUFNJPNGGDLTL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne?
The IUPAC name of methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne (CID 144521771) is methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne.
What is the SMILES notation for methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne?
The canonical SMILES for methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne is C.C.C#CC.Cc1cccc(C(C)C)c1.
What is the InChIKey of methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne?
The InChIKey is YWUFNJPNGGDLTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C3H4.2CH4/c1-8(2)10-6-4-5-9(3)7-10;1-3-2;;/h4-8H,1-3H3;1H,2H3;2*1H4.
What are the key properties of methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne?
methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne has a molecular weight of 206.37 g/mol, XLogP of 5.03, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methyl-3-propan-2-ylbenzene;prop-1-yne is sourced from PubChem (CID 144521771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).