C16H23F4N — CID 79647158
1-[2,4-di(propan-2-yl)phenyl]-2,2,3,3-tetrafluoro-N-methylpropan-1-amine (PubChem CID 79647158) has the molecular formula C16H23F4N and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-[2,4-di(propan-2-yl)phenyl]-2,2,3,3-tetrafluoro-N-methylpropan-1-amine.
| Compound Name | 1-[2,4-di(propan-2-yl)phenyl]-2,2,3,3-tetrafluoro-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 79647158 |
| Molecular Formula | C16H23F4N |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 1-[2,4-di(propan-2-yl)phenyl]-2,2,3,3-tetrafluoro-N-methylpropan-1-amine |
| SMILES | CNC(c1ccc(C(C)C)cc1C(C)C)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H23F4N/c1-9(2)11-6-7-12(13(8-11)10(3)4)14(21-5)16(19,20)15(17)18/h6-10,14-15,21H,1-5H3 |
| InChIKey | LOSQHQAWTADDPP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|