C13H17F4NO3 — CID 79644822
2,2,3,3-tetrafluoro-N-methyl-1-(2,3,4-trimethoxyphenyl)propan-1-amine (PubChem CID 79644822) has the molecular formula C13H17F4NO3 and a molecular weight of 311.28 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-methyl-1-(2,3,4-trimethoxyphenyl)propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-methyl-1-(2,3,4-trimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 79644822 |
| Molecular Formula | C13H17F4NO3 |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-methyl-1-(2,3,4-trimethoxyphenyl)propan-1-amine |
| SMILES | CNC(c1ccc(OC)c(OC)c1OC)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H17F4NO3/c1-18-11(13(16,17)12(14)15)7-5-6-8(19-2)10(21-4)9(7)20-3/h5-6,11-12,18H,1-4H3 |
| InChIKey | JXHJUYRRPSVMGW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|