C14H19F3O2 — CID 55096279
1-(4-ethylphenyl)-4-(2,2,2-trifluoroethoxy)butan-1-ol (PubChem CID 55096279) has the molecular formula C14H19F3O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-4-(2,2,2-trifluoroethoxy)butan-1-ol.
| Compound Name | 1-(4-ethylphenyl)-4-(2,2,2-trifluoroethoxy)butan-1-ol |
|---|---|
| PubChem CID | 55096279 |
| Molecular Formula | C14H19F3O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-(4-ethylphenyl)-4-(2,2,2-trifluoroethoxy)butan-1-ol |
| SMILES | CCc1ccc(C(O)CCCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3O2/c1-2-11-5-7-12(8-6-11)13(18)4-3-9-19-10-14(15,16)17/h5-8,13,18H,2-4,9-10H2,1H3 |
| InChIKey | ILUYOSRAYFOHNN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|