C21H26F3NO4 — CID 166517138
1-[bis[(4-methoxyphenyl)methyl]amino]-3-(2,2,2-trifluoroethoxy)propan-1-ol (PubChem CID 166517138) has the molecular formula C21H26F3NO4 and a molecular weight of 413.44 g/mol. Its IUPAC name is 1-[bis[(4-methoxyphenyl)methyl]amino]-3-(2,2,2-trifluoroethoxy)propan-1-ol.
| Compound Name | 1-[bis[(4-methoxyphenyl)methyl]amino]-3-(2,2,2-trifluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 166517138 |
| Molecular Formula | C21H26F3NO4 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 1-[bis[(4-methoxyphenyl)methyl]amino]-3-(2,2,2-trifluoroethoxy)propan-1-ol |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)C(O)CCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H26F3NO4/c1-27-18-7-3-16(4-8-18)13-25(14-17-5-9-19(28-2)10-6-17)20(26)11-12-29-15-21(22,23)24/h3-10,20,26H,11-15H2,1-2H3 |
| InChIKey | NTXCYTSTNRPFGS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|