C15H23F3N2O — CID 61491169
4-[[propan-2-yl-[3-(2,2,2-trifluoroethoxy)propyl]amino]methyl]aniline (PubChem CID 61491169) has the molecular formula C15H23F3N2O and a molecular weight of 304.36 g/mol. Its IUPAC name is 4-[[propan-2-yl-[3-(2,2,2-trifluoroethoxy)propyl]amino]methyl]aniline.
| Compound Name | 4-[[propan-2-yl-[3-(2,2,2-trifluoroethoxy)propyl]amino]methyl]aniline |
|---|---|
| PubChem CID | 61491169 |
| Molecular Formula | C15H23F3N2O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 4-[[propan-2-yl-[3-(2,2,2-trifluoroethoxy)propyl]amino]methyl]aniline |
| SMILES | CC(C)N(CCCOCC(F)(F)F)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C15H23F3N2O/c1-12(2)20(8-3-9-21-11-15(16,17)18)10-13-4-6-14(19)7-5-13/h4-7,12H,3,8-11,19H2,1-2H3 |
| InChIKey | AWGRJTABFAZUEY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|