About 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol
3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol (PubChem CID 62015613) has the molecular formula C10H20F3NO2
and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol |
| PubChem CID | 62015613 |
| Molecular Formula | C10H20F3NO2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol |
| SMILES | CC(C)N(CCCO)CCOCC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO2/c1-9(2)14(4-3-6-15)5-7-16-8-10(11,12)13/h9,15H,3-8H2,1-2H3 |
| InChIKey | GSMDWFCWVPQUNQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol?
The IUPAC name of 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol (CID 62015613) is 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol.
What is the SMILES notation for 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol?
The canonical SMILES for 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol is CC(C)N(CCCO)CCOCC(F)(F)F.
What is the InChIKey of 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol?
The InChIKey is GSMDWFCWVPQUNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3NO2/c1-9(2)14(4-3-6-15)5-7-16-8-10(11,12)13/h9,15H,3-8H2,1-2H3.
What are the key properties of 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol?
3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol has a molecular weight of 243.27 g/mol, XLogP of 1.66, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol is sourced from PubChem (CID 62015613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).