C8H12F5NO2 — CID 145366185
2,2,4,4,4-pentafluoro-3-morpholin-4-ylbutan-1-ol (PubChem CID 145366185) has the molecular formula C8H12F5NO2 and a molecular weight of 249.18 g/mol. Its IUPAC name is 2,2,4,4,4-pentafluoro-3-morpholin-4-ylbutan-1-ol.
| Compound Name | 2,2,4,4,4-pentafluoro-3-morpholin-4-ylbutan-1-ol |
|---|---|
| PubChem CID | 145366185 |
| Molecular Formula | C8H12F5NO2 |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2,2,4,4,4-pentafluoro-3-morpholin-4-ylbutan-1-ol |
| SMILES | OCC(F)(F)C(N1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C8H12F5NO2/c9-7(10,5-15)6(8(11,12)13)14-1-3-16-4-2-14/h6,15H,1-5H2 |
| InChIKey | JPLQHVZANVTCKN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |