C12H16F3NO — CID 54962007
4-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline (PubChem CID 54962007) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline.
| Compound Name | 4-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline |
|---|---|
| PubChem CID | 54962007 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline |
| SMILES | CCc1ccc(NCCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F3NO/c1-2-10-3-5-11(6-4-10)16-7-8-17-9-12(13,14)15/h3-6,16H,2,7-9H2,1H3 |
| InChIKey | XRWKSTAIVKSANA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|