C12H15F3N2O3 — CID 63832853
methyl 2-amino-5-[2-(2,2,2-trifluoroethoxy)ethylamino]benzoate (PubChem CID 63832853) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is methyl 2-amino-5-[2-(2,2,2-trifluoroethoxy)ethylamino]benzoate.
| Compound Name | methyl 2-amino-5-[2-(2,2,2-trifluoroethoxy)ethylamino]benzoate |
|---|---|
| PubChem CID | 63832853 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | methyl 2-amino-5-[2-(2,2,2-trifluoroethoxy)ethylamino]benzoate |
| SMILES | COC(=O)c1cc(NCCOCC(F)(F)F)ccc1N |
| InChI | InChI=1S/C12H15F3N2O3/c1-19-11(18)9-6-8(2-3-10(9)16)17-4-5-20-7-12(13,14)15/h2-3,6,17H,4-5,7,16H2,1H3 |
| InChIKey | FPFWQQZNAYMTRZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|