C12H14ClF3O — CID 103210637
1-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]-4-ethylbenzene (PubChem CID 103210637) has the molecular formula C12H14ClF3O and a molecular weight of 266.69 g/mol. Its IUPAC name is 1-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]-4-ethylbenzene.
| Compound Name | 1-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]-4-ethylbenzene |
|---|---|
| PubChem CID | 103210637 |
| Molecular Formula | C12H14ClF3O |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]-4-ethylbenzene |
| SMILES | CCc1ccc(C(Cl)COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14ClF3O/c1-2-9-3-5-10(6-4-9)11(13)7-17-8-12(14,15)16/h3-6,11H,2,7-8H2,1H3 |
| InChIKey | ZNUIKZSDUHSHSD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|