C13H13ClF3NO2 — CID 103211141
7-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 103211141) has the molecular formula C13H13ClF3NO2 and a molecular weight of 307.70 g/mol. Its IUPAC name is 7-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 7-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 103211141 |
| Molecular Formula | C13H13ClF3NO2 |
| Molecular Weight | 307.70 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 7-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCCc2ccc(C(Cl)COCC(F)(F)F)cc21 |
| InChI | InChI=1S/C13H13ClF3NO2/c14-11(6-20-7-13(15,16)17)9-2-1-8-3-4-18-12(19)10(8)5-9/h1-2,5,11H,3-4,6-7H2,(H,18,19) |
| InChIKey | GOSNNFKWZFJYPE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.70 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|