C14H10Br2ClNOS — CID 80538873
7-[chloro-(4,5-dibromothiophen-2-yl)methyl]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 80538873) has the molecular formula C14H10Br2ClNOS and a molecular weight of 435.57 g/mol. Its IUPAC name is 7-[chloro-(4,5-dibromothiophen-2-yl)methyl]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 7-[chloro-(4,5-dibromothiophen-2-yl)methyl]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 80538873 |
| Molecular Formula | C14H10Br2ClNOS |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 432.85 |
| IUPAC Name | 7-[chloro-(4,5-dibromothiophen-2-yl)methyl]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCCc2ccc(C(Cl)c3cc(Br)c(Br)s3)cc21 |
| InChI | InChI=1S/C14H10Br2ClNOS/c15-10-6-11(20-13(10)16)12(17)8-2-1-7-3-4-18-14(19)9(7)5-8/h1-2,5-6,12H,3-4H2,(H,18,19) |
| InChIKey | OBZMUJKYHNNTGR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|