C12H14ClNO — CID 104526384
8-(1-chloroethyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one (PubChem CID 104526384) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is 8-(1-chloroethyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one.
| Compound Name | 8-(1-chloroethyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
|---|---|
| PubChem CID | 104526384 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 8-(1-chloroethyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
| SMILES | CC(Cl)c1ccc2c(c1)C(=O)NCCC2 |
| InChI | InChI=1S/C12H14ClNO/c1-8(13)10-5-4-9-3-2-6-14-12(15)11(9)7-10/h4-5,7-8H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | ZHVAOELEHFQRSI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|