C15H20BrNO3S — CID 104526511
8-(1-bromo-2-methyl-2-methylsulfonylpropyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one (PubChem CID 104526511) has the molecular formula C15H20BrNO3S and a molecular weight of 374.30 g/mol. Its IUPAC name is 8-(1-bromo-2-methyl-2-methylsulfonylpropyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one.
| Compound Name | 8-(1-bromo-2-methyl-2-methylsulfonylpropyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
|---|---|
| PubChem CID | 104526511 |
| Molecular Formula | C15H20BrNO3S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 8-(1-bromo-2-methyl-2-methylsulfonylpropyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
| SMILES | CC(C)(C(Br)c1ccc2c(c1)C(=O)NCCC2)S(C)(=O)=O |
| InChI | InChI=1S/C15H20BrNO3S/c1-15(2,21(3,19)20)13(16)11-7-6-10-5-4-8-17-14(18)12(10)9-11/h6-7,9,13H,4-5,8H2,1-3H3,(H,17,18) |
| InChIKey | MEDYJFVGRZEOSZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|