C16H16BrNO2S — CID 104526492
8-[bromo-(4-methoxythiophen-2-yl)methyl]-2,3,4,5-tetrahydro-2-benzazepin-1-one (PubChem CID 104526492) has the molecular formula C16H16BrNO2S and a molecular weight of 366.28 g/mol. Its IUPAC name is 8-[bromo-(4-methoxythiophen-2-yl)methyl]-2,3,4,5-tetrahydro-2-benzazepin-1-one.
| Compound Name | 8-[bromo-(4-methoxythiophen-2-yl)methyl]-2,3,4,5-tetrahydro-2-benzazepin-1-one |
|---|---|
| PubChem CID | 104526492 |
| Molecular Formula | C16H16BrNO2S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 8-[bromo-(4-methoxythiophen-2-yl)methyl]-2,3,4,5-tetrahydro-2-benzazepin-1-one |
| SMILES | COc1csc(C(Br)c2ccc3c(c2)C(=O)NCCC3)c1 |
| InChI | InChI=1S/C16H16BrNO2S/c1-20-12-8-14(21-9-12)15(17)11-5-4-10-3-2-6-18-16(19)13(10)7-11/h4-5,7-9,15H,2-3,6H2,1H3,(H,18,19) |
| InChIKey | XEQJNDXGVOPJHD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|