C14H15BrF3NO — CID 104526472
8-(1-bromo-4,4,4-trifluorobutyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one (PubChem CID 104526472) has the molecular formula C14H15BrF3NO and a molecular weight of 350.18 g/mol. Its IUPAC name is 8-(1-bromo-4,4,4-trifluorobutyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one.
| Compound Name | 8-(1-bromo-4,4,4-trifluorobutyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
|---|---|
| PubChem CID | 104526472 |
| Molecular Formula | C14H15BrF3NO |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 8-(1-bromo-4,4,4-trifluorobutyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
| SMILES | O=C1NCCCc2ccc(C(Br)CCC(F)(F)F)cc21 |
| InChI | InChI=1S/C14H15BrF3NO/c15-12(5-6-14(16,17)18)10-4-3-9-2-1-7-19-13(20)11(9)8-10/h3-4,8,12H,1-2,5-7H2,(H,19,20) |
| InChIKey | XXLBLGLQLYWUFL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|