C17H22ClNO — CID 104526446
8-[chloro(cyclohexyl)methyl]-2,3,4,5-tetrahydro-2-benzazepin-1-one (PubChem CID 104526446) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is 8-[chloro(cyclohexyl)methyl]-2,3,4,5-tetrahydro-2-benzazepin-1-one.
| Compound Name | 8-[chloro(cyclohexyl)methyl]-2,3,4,5-tetrahydro-2-benzazepin-1-one |
|---|---|
| PubChem CID | 104526446 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 8-[chloro(cyclohexyl)methyl]-2,3,4,5-tetrahydro-2-benzazepin-1-one |
| SMILES | O=C1NCCCc2ccc(C(Cl)C3CCCCC3)cc21 |
| InChI | InChI=1S/C17H22ClNO/c18-16(13-5-2-1-3-6-13)14-9-8-12-7-4-10-19-17(20)15(12)11-14/h8-9,11,13,16H,1-7,10H2,(H,19,20) |
| InChIKey | SGKMQIFNQKCTQL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|