C13H17F3O — CID 115515423
1-(4-ethylphenyl)-5,5,5-trifluoropentan-1-ol (PubChem CID 115515423) has the molecular formula C13H17F3O and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-5,5,5-trifluoropentan-1-ol.
| Compound Name | 1-(4-ethylphenyl)-5,5,5-trifluoropentan-1-ol |
|---|---|
| PubChem CID | 115515423 |
| Molecular Formula | C13H17F3O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-(4-ethylphenyl)-5,5,5-trifluoropentan-1-ol |
| SMILES | CCc1ccc(C(O)CCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3O/c1-2-10-5-7-11(8-6-10)12(17)4-3-9-13(14,15)16/h5-8,12,17H,2-4,9H2,1H3 |
| InChIKey | HYQMAUXFSRXPQA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |