C12H15F3OS — CID 106848279
1-(4-ethylsulfanylphenyl)-4,4,4-trifluorobutan-1-ol (PubChem CID 106848279) has the molecular formula C12H15F3OS and a molecular weight of 264.31 g/mol. Its IUPAC name is 1-(4-ethylsulfanylphenyl)-4,4,4-trifluorobutan-1-ol.
| Compound Name | 1-(4-ethylsulfanylphenyl)-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 106848279 |
| Molecular Formula | C12H15F3OS |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1-(4-ethylsulfanylphenyl)-4,4,4-trifluorobutan-1-ol |
| SMILES | CCSc1ccc(C(O)CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3OS/c1-2-17-10-5-3-9(4-6-10)11(16)7-8-12(13,14)15/h3-6,11,16H,2,7-8H2,1H3 |
| InChIKey | SPGBBQUOEDJEDW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |