C11H13F3O3 — CID 79566446
2-ethoxy-1-[4-(trifluoromethoxy)phenyl]ethanol (PubChem CID 79566446) has the molecular formula C11H13F3O3 and a molecular weight of 250.22 g/mol. Its IUPAC name is 2-ethoxy-1-[4-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | 2-ethoxy-1-[4-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 79566446 |
| Molecular Formula | C11H13F3O3 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-ethoxy-1-[4-(trifluoromethoxy)phenyl]ethanol |
| SMILES | CCOCC(O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3O3/c1-2-16-7-10(15)8-3-5-9(6-4-8)17-11(12,13)14/h3-6,10,15H,2,7H2,1H3 |
| InChIKey | IWZRKRWLRAAANN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |