C13H14F3NO2 — CID 79136280
2-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]-2-methylbutanenitrile (PubChem CID 79136280) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]-2-methylbutanenitrile.
| Compound Name | 2-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]-2-methylbutanenitrile |
|---|---|
| PubChem CID | 79136280 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]-2-methylbutanenitrile |
| SMILES | CCC(C)(C#N)C(O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3NO2/c1-3-12(2,8-17)11(18)9-4-6-10(7-5-9)19-13(14,15)16/h4-7,11,18H,3H2,1-2H3 |
| InChIKey | UCGQWKMKHJIJTR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |