C14H20F2O2 — CID 82006561
1-(4-tert-butylphenyl)-2-(2,2-difluoroethoxy)ethanol (PubChem CID 82006561) has the molecular formula C14H20F2O2 and a molecular weight of 258.31 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-(2,2-difluoroethoxy)ethanol.
| Compound Name | 1-(4-tert-butylphenyl)-2-(2,2-difluoroethoxy)ethanol |
|---|---|
| PubChem CID | 82006561 |
| Molecular Formula | C14H20F2O2 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-(2,2-difluoroethoxy)ethanol |
| SMILES | CC(C)(C)c1ccc(C(O)COCC(F)F)cc1 |
| InChI | InChI=1S/C14H20F2O2/c1-14(2,3)11-6-4-10(5-7-11)12(17)8-18-9-13(15)16/h4-7,12-13,17H,8-9H2,1-3H3 |
| InChIKey | VNHMWQXGIZBFOZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |