C13H18F2O2 — CID 82007292
2-(2,2-difluoroethoxy)-1-(4-propylphenyl)ethanol (PubChem CID 82007292) has the molecular formula C13H18F2O2 and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-1-(4-propylphenyl)ethanol.
| Compound Name | 2-(2,2-difluoroethoxy)-1-(4-propylphenyl)ethanol |
|---|---|
| PubChem CID | 82007292 |
| Molecular Formula | C13H18F2O2 |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-1-(4-propylphenyl)ethanol |
| SMILES | CCCc1ccc(C(O)COCC(F)F)cc1 |
| InChI | InChI=1S/C13H18F2O2/c1-2-3-10-4-6-11(7-5-10)12(16)8-17-9-13(14)15/h4-7,12-13,16H,2-3,8-9H2,1H3 |
| InChIKey | FRELOARXDHRVGZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |