C19H21IO — CID 63492494
[2,4-di(propan-2-yl)phenyl]-(4-iodophenyl)methanone (PubChem CID 63492494) has the molecular formula C19H21IO and a molecular weight of 392.28 g/mol. Its IUPAC name is [2,4-di(propan-2-yl)phenyl]-(4-iodophenyl)methanone.
| Compound Name | [2,4-di(propan-2-yl)phenyl]-(4-iodophenyl)methanone |
|---|---|
| PubChem CID | 63492494 |
| Molecular Formula | C19H21IO |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | [2,4-di(propan-2-yl)phenyl]-(4-iodophenyl)methanone |
| SMILES | CC(C)c1ccc(C(=O)c2ccc(I)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C19H21IO/c1-12(2)15-7-10-17(18(11-15)13(3)4)19(21)14-5-8-16(20)9-6-14/h5-13H,1-4H3 |
| InChIKey | UTBOQWGZGMDBEH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|