C23H36O4 — CID 101184353
2-ethyl-2-hydroperoxy-4-methyl-1-[2,4,6-tri(propan-2-yl)phenyl]pentane-1,3-dione (PubChem CID 101184353) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is 2-ethyl-2-hydroperoxy-4-methyl-1-[2,4,6-tri(propan-2-yl)phenyl]pentane-1,3-dione.
| Compound Name | 2-ethyl-2-hydroperoxy-4-methyl-1-[2,4,6-tri(propan-2-yl)phenyl]pentane-1,3-dione |
|---|---|
| PubChem CID | 101184353 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 2-ethyl-2-hydroperoxy-4-methyl-1-[2,4,6-tri(propan-2-yl)phenyl]pentane-1,3-dione |
| SMILES | CCC(OO)(C(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C23H36O4/c1-10-23(27-26,21(24)16(8)9)22(25)20-18(14(4)5)11-17(13(2)3)12-19(20)15(6)7/h11-16,26H,10H2,1-9H3 |
| InChIKey | IVGQCPJVIGNIBM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|