C19H25ClO — CID 79096016
2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran (PubChem CID 79096016) has the molecular formula C19H25ClO and a molecular weight of 304.86 g/mol. Its IUPAC name is 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran.
| Compound Name | 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran |
|---|---|
| PubChem CID | 79096016 |
| Molecular Formula | C19H25ClO |
| Molecular Weight | 304.86 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran |
| SMILES | CCc1ccc(C(Cl)c2ccc(C(C)C)cc2C(C)C)o1 |
| InChI | InChI=1S/C19H25ClO/c1-6-15-8-10-18(21-15)19(20)16-9-7-14(12(2)3)11-17(16)13(4)5/h7-13,19H,6H2,1-5H3 |
| InChIKey | XNPBIBVUJBWZCB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.86 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|