About 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran
2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran (PubChem CID 79096016) has the molecular formula C19H25ClO
and a molecular weight of 304.86 g/mol. Its IUPAC name is 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran.
Molecular Properties
| Compound Name | 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran |
| PubChem CID | 79096016 |
| Molecular Formula | C19H25ClO |
| Molecular Weight | 304.86 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran |
| SMILES | CCc1ccc(C(Cl)c2ccc(C(C)C)cc2C(C)C)o1 |
| InChI | InChI=1S/C19H25ClO/c1-6-15-8-10-18(21-15)19(20)16-9-7-14(12(2)3)11-17(16)13(4)5/h7-13,19H,6H2,1-5H3 |
| InChIKey | XNPBIBVUJBWZCB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.86 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran?
The IUPAC name of 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran (CID 79096016) is 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran.
What is the SMILES notation for 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran?
The canonical SMILES for 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran is CCc1ccc(C(Cl)c2ccc(C(C)C)cc2C(C)C)o1.
What is the InChIKey of 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran?
The InChIKey is XNPBIBVUJBWZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25ClO/c1-6-15-8-10-18(21-15)19(20)16-9-7-14(12(2)3)11-17(16)13(4)5/h7-13,19H,6H2,1-5H3.
What are the key properties of 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran?
2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran has a molecular weight of 304.86 g/mol, XLogP of 6.42, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-5-ethylfuran is sourced from PubChem (CID 79096016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).