C18H23ClO — CID 79084543
2-[chloro-(2,3,4,5,6-pentamethylphenyl)methyl]-5-ethylfuran (PubChem CID 79084543) has the molecular formula C18H23ClO and a molecular weight of 290.83 g/mol. Its IUPAC name is 2-[chloro-(2,3,4,5,6-pentamethylphenyl)methyl]-5-ethylfuran.
| Compound Name | 2-[chloro-(2,3,4,5,6-pentamethylphenyl)methyl]-5-ethylfuran |
|---|---|
| PubChem CID | 79084543 |
| Molecular Formula | C18H23ClO |
| Molecular Weight | 290.83 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-[chloro-(2,3,4,5,6-pentamethylphenyl)methyl]-5-ethylfuran |
| SMILES | CCc1ccc(C(Cl)c2c(C)c(C)c(C)c(C)c2C)o1 |
| InChI | InChI=1S/C18H23ClO/c1-7-15-8-9-16(20-15)18(19)17-13(5)11(3)10(2)12(4)14(17)6/h8-9,18H,7H2,1-6H3 |
| InChIKey | RBXFKNWURUFORR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.83 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|