C15H21BrO4S — CID 104661167
(3-bromo-4-propoxyphenyl)-(1,1-dioxothian-2-yl)methanol (PubChem CID 104661167) has the molecular formula C15H21BrO4S and a molecular weight of 377.30 g/mol. Its IUPAC name is (3-bromo-4-propoxyphenyl)-(1,1-dioxothian-2-yl)methanol.
| Compound Name | (3-bromo-4-propoxyphenyl)-(1,1-dioxothian-2-yl)methanol |
|---|---|
| PubChem CID | 104661167 |
| Molecular Formula | C15H21BrO4S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | (3-bromo-4-propoxyphenyl)-(1,1-dioxothian-2-yl)methanol |
| SMILES | CCCOc1ccc(C(O)C2CCCCS2(=O)=O)cc1Br |
| InChI | InChI=1S/C15H21BrO4S/c1-2-8-20-13-7-6-11(10-12(13)16)15(17)14-5-3-4-9-21(14,18)19/h6-7,10,14-15,17H,2-5,8-9H2,1H3 |
| InChIKey | LMUUMQSAKOGKDL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |