C16H16BrFO2 — CID 104661170
(3-bromo-4-propoxyphenyl)-(4-fluorophenyl)methanol (PubChem CID 104661170) has the molecular formula C16H16BrFO2 and a molecular weight of 339.20 g/mol. Its IUPAC name is (3-bromo-4-propoxyphenyl)-(4-fluorophenyl)methanol.
| Compound Name | (3-bromo-4-propoxyphenyl)-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 104661170 |
| Molecular Formula | C16H16BrFO2 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | (3-bromo-4-propoxyphenyl)-(4-fluorophenyl)methanol |
| SMILES | CCCOc1ccc(C(O)c2ccc(F)cc2)cc1Br |
| InChI | InChI=1S/C16H16BrFO2/c1-2-9-20-15-8-5-12(10-14(15)17)16(19)11-3-6-13(18)7-4-11/h3-8,10,16,19H,2,9H2,1H3 |
| InChIKey | GHLTTZOHBNVVLF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |