C16H14BrClF2O — CID 104661943
1-[(3-bromo-4-propoxyphenyl)-chloromethyl]-2,4-difluorobenzene (PubChem CID 104661943) has the molecular formula C16H14BrClF2O and a molecular weight of 375.64 g/mol. Its IUPAC name is 1-[(3-bromo-4-propoxyphenyl)-chloromethyl]-2,4-difluorobenzene.
| Compound Name | 1-[(3-bromo-4-propoxyphenyl)-chloromethyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 104661943 |
| Molecular Formula | C16H14BrClF2O |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 1-[(3-bromo-4-propoxyphenyl)-chloromethyl]-2,4-difluorobenzene |
| SMILES | CCCOc1ccc(C(Cl)c2ccc(F)cc2F)cc1Br |
| InChI | InChI=1S/C16H14BrClF2O/c1-2-7-21-15-6-3-10(8-13(15)17)16(18)12-5-4-11(19)9-14(12)20/h3-6,8-9,16H,2,7H2,1H3 |
| InChIKey | YMRGMQNBMNJNLR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|