C17H17Br2ClO — CID 107983638
2-bromo-1-[(3-bromo-4-propoxyphenyl)-chloromethyl]-3-methylbenzene (PubChem CID 107983638) has the molecular formula C17H17Br2ClO and a molecular weight of 432.58 g/mol. Its IUPAC name is 2-bromo-1-[(3-bromo-4-propoxyphenyl)-chloromethyl]-3-methylbenzene.
| Compound Name | 2-bromo-1-[(3-bromo-4-propoxyphenyl)-chloromethyl]-3-methylbenzene |
|---|---|
| PubChem CID | 107983638 |
| Molecular Formula | C17H17Br2ClO |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | 2-bromo-1-[(3-bromo-4-propoxyphenyl)-chloromethyl]-3-methylbenzene |
| SMILES | CCCOc1ccc(C(Cl)c2cccc(C)c2Br)cc1Br |
| InChI | InChI=1S/C17H17Br2ClO/c1-3-9-21-15-8-7-12(10-14(15)18)17(20)13-6-4-5-11(2)16(13)19/h4-8,10,17H,3,9H2,1-2H3 |
| InChIKey | WRJZTIUOGUKDAC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|