C14H13Br2ClOS — CID 104661972
2-bromo-5-[(3-bromo-4-propoxyphenyl)-chloromethyl]thiophene (PubChem CID 104661972) has the molecular formula C14H13Br2ClOS and a molecular weight of 424.59 g/mol. Its IUPAC name is 2-bromo-5-[(3-bromo-4-propoxyphenyl)-chloromethyl]thiophene.
| Compound Name | 2-bromo-5-[(3-bromo-4-propoxyphenyl)-chloromethyl]thiophene |
|---|---|
| PubChem CID | 104661972 |
| Molecular Formula | C14H13Br2ClOS |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 421.87 |
| IUPAC Name | 2-bromo-5-[(3-bromo-4-propoxyphenyl)-chloromethyl]thiophene |
| SMILES | CCCOc1ccc(C(Cl)c2ccc(Br)s2)cc1Br |
| InChI | InChI=1S/C14H13Br2ClOS/c1-2-7-18-11-4-3-9(8-10(11)15)14(17)12-5-6-13(16)19-12/h3-6,8,14H,2,7H2,1H3 |
| InChIKey | DYXQWYCUIONRSN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|