C15H16Br2OS — CID 104662068
2-[bromo-(3-bromo-4-propoxyphenyl)methyl]-5-methylthiophene (PubChem CID 104662068) has the molecular formula C15H16Br2OS and a molecular weight of 404.17 g/mol. Its IUPAC name is 2-[bromo-(3-bromo-4-propoxyphenyl)methyl]-5-methylthiophene.
| Compound Name | 2-[bromo-(3-bromo-4-propoxyphenyl)methyl]-5-methylthiophene |
|---|---|
| PubChem CID | 104662068 |
| Molecular Formula | C15H16Br2OS |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 401.93 |
| IUPAC Name | 2-[bromo-(3-bromo-4-propoxyphenyl)methyl]-5-methylthiophene |
| SMILES | CCCOc1ccc(C(Br)c2ccc(C)s2)cc1Br |
| InChI | InChI=1S/C15H16Br2OS/c1-3-8-18-13-6-5-11(9-12(13)16)15(17)14-7-4-10(2)19-14/h4-7,9,15H,3,8H2,1-2H3 |
| InChIKey | ZIPGQTJGGZCCDJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|