C17H20Br2O2 — CID 104662177
3-[bromo-(3-bromo-4-propoxyphenyl)methyl]-2,4,5-trimethylfuran (PubChem CID 104662177) has the molecular formula C17H20Br2O2 and a molecular weight of 416.15 g/mol. Its IUPAC name is 3-[bromo-(3-bromo-4-propoxyphenyl)methyl]-2,4,5-trimethylfuran.
| Compound Name | 3-[bromo-(3-bromo-4-propoxyphenyl)methyl]-2,4,5-trimethylfuran |
|---|---|
| PubChem CID | 104662177 |
| Molecular Formula | C17H20Br2O2 |
| Molecular Weight | 416.15 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | 3-[bromo-(3-bromo-4-propoxyphenyl)methyl]-2,4,5-trimethylfuran |
| SMILES | CCCOc1ccc(C(Br)c2c(C)oc(C)c2C)cc1Br |
| InChI | InChI=1S/C17H20Br2O2/c1-5-8-20-15-7-6-13(9-14(15)18)17(19)16-10(2)11(3)21-12(16)4/h6-7,9,17H,5,8H2,1-4H3 |
| InChIKey | XDQDUYBVIHKVJA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.15 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|