C14H14BrClO2S — CID 104661241
(3-bromo-4-propoxyphenyl)-(5-chlorothiophen-2-yl)methanol (PubChem CID 104661241) has the molecular formula C14H14BrClO2S and a molecular weight of 361.69 g/mol. Its IUPAC name is (3-bromo-4-propoxyphenyl)-(5-chlorothiophen-2-yl)methanol.
| Compound Name | (3-bromo-4-propoxyphenyl)-(5-chlorothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 104661241 |
| Molecular Formula | C14H14BrClO2S |
| Molecular Weight | 361.69 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | (3-bromo-4-propoxyphenyl)-(5-chlorothiophen-2-yl)methanol |
| SMILES | CCCOc1ccc(C(O)c2ccc(Cl)s2)cc1Br |
| InChI | InChI=1S/C14H14BrClO2S/c1-2-7-18-11-4-3-9(8-10(11)15)14(17)12-5-6-13(16)19-12/h3-6,8,14,17H,2,7H2,1H3 |
| InChIKey | XJBUORSVZVDQGY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.69 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |