C12H10ClF4N3S — CID 106786780
[2-(2-chloro-4-fluorophenyl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]hydrazine (PubChem CID 106786780) has the molecular formula C12H10ClF4N3S and a molecular weight of 339.75 g/mol. Its IUPAC name is [2-(2-chloro-4-fluorophenyl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]hydrazine.
| Compound Name | [2-(2-chloro-4-fluorophenyl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]hydrazine |
|---|---|
| PubChem CID | 106786780 |
| Molecular Formula | C12H10ClF4N3S |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | [2-(2-chloro-4-fluorophenyl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(F)cc1Cl)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C12H10ClF4N3S/c13-8-4-7(14)2-1-6(8)3-9(20-18)10-5-19-11(21-10)12(15,16)17/h1-2,4-5,9,20H,3,18H2 |
| InChIKey | ZAJCXRDTMDKNBA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|