C12H16F2N2S2 — CID 105259663
[(3,5-difluorophenyl)-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine (PubChem CID 105259663) has the molecular formula C12H16F2N2S2 and a molecular weight of 290.40 g/mol. Its IUPAC name is [(3,5-difluorophenyl)-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine.
| Compound Name | [(3,5-difluorophenyl)-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105259663 |
| Molecular Formula | C12H16F2N2S2 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | [(3,5-difluorophenyl)-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine |
| SMILES | CC1SCCSC1C(NN)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16F2N2S2/c1-7-12(18-3-2-17-7)11(16-15)8-4-9(13)6-10(14)5-8/h4-7,11-12,16H,2-3,15H2,1H3 |
| InChIKey | JQQBVGGJQYOJHJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|