C15H22N2OS2 — CID 105259732
[3,4-dihydro-2H-chromen-8-yl-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine (PubChem CID 105259732) has the molecular formula C15H22N2OS2 and a molecular weight of 310.49 g/mol. Its IUPAC name is [3,4-dihydro-2H-chromen-8-yl-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-chromen-8-yl-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105259732 |
| Molecular Formula | C15H22N2OS2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | [3,4-dihydro-2H-chromen-8-yl-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine |
| SMILES | CC1SCCSC1C(NN)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C15H22N2OS2/c1-10-15(20-9-8-19-10)13(17-16)12-6-2-4-11-5-3-7-18-14(11)12/h2,4,6,10,13,15,17H,3,5,7-9,16H2,1H3 |
| InChIKey | QJALGEFXDBILPC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|