C12H22N4S2 — CID 105259494
[(3-methyl-1,4-dithian-2-yl)-(2-propylpyrazol-3-yl)methyl]hydrazine (PubChem CID 105259494) has the molecular formula C12H22N4S2 and a molecular weight of 286.47 g/mol. Its IUPAC name is [(3-methyl-1,4-dithian-2-yl)-(2-propylpyrazol-3-yl)methyl]hydrazine.
| Compound Name | [(3-methyl-1,4-dithian-2-yl)-(2-propylpyrazol-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105259494 |
| Molecular Formula | C12H22N4S2 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | [(3-methyl-1,4-dithian-2-yl)-(2-propylpyrazol-3-yl)methyl]hydrazine |
| SMILES | CCCn1nccc1C(NN)C1SCCSC1C |
| InChI | InChI=1S/C12H22N4S2/c1-3-6-16-10(4-5-14-16)11(15-13)12-9(2)17-7-8-18-12/h4-5,9,11-12,15H,3,6-8,13H2,1-2H3 |
| InChIKey | JEDCOCPODGUAMQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|