C11H20N4O2S — CID 105258804
[(1,1-dioxothiolan-3-yl)-(2-propylpyrazol-3-yl)methyl]hydrazine (PubChem CID 105258804) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is [(1,1-dioxothiolan-3-yl)-(2-propylpyrazol-3-yl)methyl]hydrazine.
| Compound Name | [(1,1-dioxothiolan-3-yl)-(2-propylpyrazol-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105258804 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | [(1,1-dioxothiolan-3-yl)-(2-propylpyrazol-3-yl)methyl]hydrazine |
| SMILES | CCCn1nccc1C(NN)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N4O2S/c1-2-6-15-10(3-5-13-15)11(14-12)9-4-7-18(16,17)8-9/h3,5,9,11,14H,2,4,6-8,12H2,1H3 |
| InChIKey | TXYIFASGIKLIBG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|