C15H20BrClFN3 — CID 106762792
N-[(4-bromo-3-chloro-2-fluorophenyl)-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]ethanamine (PubChem CID 106762792) has the molecular formula C15H20BrClFN3 and a molecular weight of 376.70 g/mol. Its IUPAC name is N-[(4-bromo-3-chloro-2-fluorophenyl)-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106762792 |
| Molecular Formula | C15H20BrClFN3 |
| Molecular Weight | 376.70 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Br)c(Cl)c1F)C1CN2CCN1CC2 |
| InChI | InChI=1S/C15H20BrClFN3/c1-2-19-15(10-3-4-11(16)13(17)14(10)18)12-9-20-5-7-21(12)8-6-20/h3-4,12,15,19H,2,5-9H2,1H3 |
| InChIKey | NJCZTJNXIRWXOM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|