C11H11BrCl2 — CID 63444578
2-(1-bromo-2-cyclopropylethyl)-1,4-dichlorobenzene (PubChem CID 63444578) has the molecular formula C11H11BrCl2 and a molecular weight of 294.02 g/mol. Its IUPAC name is 2-(1-bromo-2-cyclopropylethyl)-1,4-dichlorobenzene.
| Compound Name | 2-(1-bromo-2-cyclopropylethyl)-1,4-dichlorobenzene |
|---|---|
| PubChem CID | 63444578 |
| Molecular Formula | C11H11BrCl2 |
| Molecular Weight | 294.02 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | 2-(1-bromo-2-cyclopropylethyl)-1,4-dichlorobenzene |
| SMILES | Clc1ccc(Cl)c(C(Br)CC2CC2)c1 |
| InChI | InChI=1S/C11H11BrCl2/c12-10(5-7-1-2-7)9-6-8(13)3-4-11(9)14/h3-4,6-7,10H,1-2,5H2 |
| InChIKey | RNATZBGCNVYRPY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.02 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|